C15H17F2NO2 — CID 69324750
1-cyclobutyl-2-(2,3-difluorophenyl)pyrrolidine-3-carboxylic acid (PubChem CID 69324750) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is 1-cyclobutyl-2-(2,3-difluorophenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-cyclobutyl-2-(2,3-difluorophenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69324750 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-cyclobutyl-2-(2,3-difluorophenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C2CCC2)C1c1cccc(F)c1F |
| InChI | InChI=1S/C15H17F2NO2/c16-12-6-2-5-10(13(12)17)14-11(15(19)20)7-8-18(14)9-3-1-4-9/h2,5-6,9,11,14H,1,3-4,7-8H2,(H,19,20) |
| InChIKey | MZJURXOUAIFUJY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |