C31H36FN3O — CID 69326478
3-[[butyl-[[3-butyl-5-(4-fluorophenyl)-2-phenylimidazol-4-yl]methyl]amino]methyl]phenol (PubChem CID 69326478) has the molecular formula C31H36FN3O and a molecular weight of 485.65 g/mol. Its IUPAC name is 3-[[butyl-[[3-butyl-5-(4-fluorophenyl)-2-phenylimidazol-4-yl]methyl]amino]methyl]phenol.
| Compound Name | 3-[[butyl-[[3-butyl-5-(4-fluorophenyl)-2-phenylimidazol-4-yl]methyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 69326478 |
| Molecular Formula | C31H36FN3O |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 3-[[butyl-[[3-butyl-5-(4-fluorophenyl)-2-phenylimidazol-4-yl]methyl]amino]methyl]phenol |
| SMILES | CCCCN(Cc1cccc(O)c1)Cc1c(-c2ccc(F)cc2)nc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C31H36FN3O/c1-3-5-19-34(22-24-11-10-14-28(36)21-24)23-29-30(25-15-17-27(32)18-16-25)33-31(35(29)20-6-4-2)26-12-8-7-9-13-26/h7-18,21,36H,3-6,19-20,22-23H2,1-2H3 |
| InChIKey | VLDRIGFYANFUHR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |