About 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol
5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol (PubChem CID 69302769) has the molecular formula C31H36N4O3
and a molecular weight of 512.65 g/mol. Its IUPAC name is 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol.
Molecular Properties
| Compound Name | 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol |
| PubChem CID | 69302769 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol |
| SMILES | CCCCN(Cc1ccc([N+](=O)[O-])c(O)c1)Cc1c(-c2ccccc2)nc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C31H36N4O3/c1-3-5-19-33(22-24-17-18-27(35(37)38)29(36)21-24)23-28-30(25-13-9-7-10-14-25)32-31(34(28)20-6-4-2)26-15-11-8-12-16-26/h7-18,21,36H,3-6,19-20,22-23H2,1-2H3 |
| InChIKey | SXUBJZCYSKFEEY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol?
The IUPAC name of 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol (CID 69302769) is 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol.
What is the SMILES notation for 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol?
The canonical SMILES for 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol is CCCCN(Cc1ccc([N+](=O)[O-])c(O)c1)Cc1c(-c2ccccc2)nc(-c2ccccc2)n1CCCC.
What is the InChIKey of 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol?
The InChIKey is SXUBJZCYSKFEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H36N4O3/c1-3-5-19-33(22-24-17-18-27(35(37)38)29(36)21-24)23-28-30(25-13-9-7-10-14-25)32-31(34(28)20-6-4-2)26-15-11-8-12-16-26/h7-18,21,36H,3-6,19-20,22-23H2,1-2H3.
What are the key properties of 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol?
5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol has a molecular weight of 512.65 g/mol, XLogP of 7.43, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-nitrophenol is sourced from PubChem (CID 69302769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).