C33H42N4O3S — CID 69326451
N-[[4-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-hydroxyphenyl]methyl]methanesulfonamide (PubChem CID 69326451) has the molecular formula C33H42N4O3S and a molecular weight of 574.79 g/mol. Its IUPAC name is N-[[4-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-hydroxyphenyl]methyl]methanesulfonamide.
| Compound Name | N-[[4-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-hydroxyphenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 69326451 |
| Molecular Formula | C33H42N4O3S |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | N-[[4-[[butyl-[(3-butyl-2,5-diphenylimidazol-4-yl)methyl]amino]methyl]-2-hydroxyphenyl]methyl]methanesulfonamide |
| SMILES | CCCCN(Cc1ccc(CNS(C)(=O)=O)c(O)c1)Cc1c(-c2ccccc2)nc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C33H42N4O3S/c1-4-6-20-36(24-26-18-19-29(31(38)22-26)23-34-41(3,39)40)25-30-32(27-14-10-8-11-15-27)35-33(37(30)21-7-5-2)28-16-12-9-13-17-28/h8-19,22,34,38H,4-7,20-21,23-25H2,1-3H3 |
| InChIKey | NJLMYEDBNNMWEY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|