C20H18N2O6 — CID 69329298
2-[[4-hydroxy-7-(2-methoxyphenoxy)isoquinoline-3-carbonyl]amino]propanoic acid (PubChem CID 69329298) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is 2-[[4-hydroxy-7-(2-methoxyphenoxy)isoquinoline-3-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[4-hydroxy-7-(2-methoxyphenoxy)isoquinoline-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 69329298 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[[4-hydroxy-7-(2-methoxyphenoxy)isoquinoline-3-carbonyl]amino]propanoic acid |
| SMILES | COc1ccccc1Oc1ccc2c(O)c(C(=O)NC(C)C(=O)O)ncc2c1 |
| InChI | InChI=1S/C20H18N2O6/c1-11(20(25)26)22-19(24)17-18(23)14-8-7-13(9-12(14)10-21-17)28-16-6-4-3-5-15(16)27-2/h3-11,23H,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | RAMRZOOLHPQLLT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |