C20H15N3O5 — CID 67110270
2-[(1-cyano-4-hydroxy-8-phenoxyisoquinoline-3-carbonyl)amino]propanoic acid (PubChem CID 67110270) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is 2-[(1-cyano-4-hydroxy-8-phenoxyisoquinoline-3-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(1-cyano-4-hydroxy-8-phenoxyisoquinoline-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 67110270 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[(1-cyano-4-hydroxy-8-phenoxyisoquinoline-3-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1nc(C#N)c2c(Oc3ccccc3)cccc2c1O)C(=O)O |
| InChI | InChI=1S/C20H15N3O5/c1-11(20(26)27)22-19(25)17-18(24)13-8-5-9-15(16(13)14(10-21)23-17)28-12-6-3-2-4-7-12/h2-9,11,24H,1H3,(H,22,25)(H,26,27) |
| InChIKey | HEEJNIOLTLADLS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 132.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |