C24H20N4O8 — CID 87120561
2,2-bis[(4-hydroxy-1-methoxyisoquinoline-3-carbonyl)amino]acetic acid (PubChem CID 87120561) has the molecular formula C24H20N4O8 and a molecular weight of 492.44 g/mol. Its IUPAC name is 2,2-bis[(4-hydroxy-1-methoxyisoquinoline-3-carbonyl)amino]acetic acid.
| Compound Name | 2,2-bis[(4-hydroxy-1-methoxyisoquinoline-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 87120561 |
| Molecular Formula | C24H20N4O8 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2,2-bis[(4-hydroxy-1-methoxyisoquinoline-3-carbonyl)amino]acetic acid |
| SMILES | COc1nc(C(=O)NC(NC(=O)c2nc(OC)c3ccccc3c2O)C(=O)O)c(O)c2ccccc12 |
| InChI | InChI=1S/C24H20N4O8/c1-35-22-13-9-5-3-7-11(13)17(29)15(25-22)20(31)27-19(24(33)34)28-21(32)16-18(30)12-8-4-6-10-14(12)23(26-16)36-2/h3-10,19,29-30H,1-2H3,(H,27,31)(H,28,32)(H,33,34) |
| InChIKey | GTZSHKWKTBZGHD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 180.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|