C17H12N2O6 — CID 69329715
3-[5-[1-(2,4,6-trioxo-1,3-diazinan-5-ylidene)ethyl]furan-2-yl]benzoic acid (PubChem CID 69329715) has the molecular formula C17H12N2O6 and a molecular weight of 340.29 g/mol. Its IUPAC name is 3-[5-[1-(2,4,6-trioxo-1,3-diazinan-5-ylidene)ethyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[1-(2,4,6-trioxo-1,3-diazinan-5-ylidene)ethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 69329715 |
| Molecular Formula | C17H12N2O6 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-[5-[1-(2,4,6-trioxo-1,3-diazinan-5-ylidene)ethyl]furan-2-yl]benzoic acid |
| SMILES | CC(=C1C(=O)NC(=O)NC1=O)c1ccc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C17H12N2O6/c1-8(13-14(20)18-17(24)19-15(13)21)11-5-6-12(25-11)9-3-2-4-10(7-9)16(22)23/h2-7H,1H3,(H,22,23)(H2,18,19,20,21,24) |
| InChIKey | LLFWJBXTQPFUCD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|