C21H12Cl2N2O5 — CID 69330416
2-chloro-5-[5-[(3-chlorophenyl)-(2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 69330416) has the molecular formula C21H12Cl2N2O5 and a molecular weight of 443.24 g/mol. Its IUPAC name is 2-chloro-5-[5-[(3-chlorophenyl)-(2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(3-chlorophenyl)-(2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 69330416 |
| Molecular Formula | C21H12Cl2N2O5 |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 2-chloro-5-[5-[(3-chlorophenyl)-(2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1NC(=O)C(=C(c2cccc(Cl)c2)c2ccc(-c3ccc(Cl)c(C(=O)O)c3)o2)N1 |
| InChI | InChI=1S/C21H12Cl2N2O5/c22-12-3-1-2-11(8-12)17(18-19(26)25-21(29)24-18)16-7-6-15(30-16)10-4-5-14(23)13(9-10)20(27)28/h1-9H,(H,27,28)(H2,24,25,26,29) |
| InChIKey | HEGISLUYPMTFCK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|