C21H24BrCl2IN4OS — CID 69334565
3-(5-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-4-methyl-N-(1-methylpiperidin-1-ium-1-yl)-3,4-dihydropyrazole-5-carboxamide iodide (PubChem CID 69334565) has the molecular formula C21H24BrCl2IN4OS and a molecular weight of 658.23 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-4-methyl-N-(1-methylpiperidin-1-ium-1-yl)-3,4-dihydropyrazole-5-carboxamide iodide.
| Compound Name | 3-(5-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-4-methyl-N-(1-methylpiperidin-1-ium-1-yl)-3,4-dihydropyrazole-5-carboxamide iodide |
|---|---|
| PubChem CID | 69334565 |
| Molecular Formula | C21H24BrCl2IN4OS |
| Molecular Weight | 658.23 g/mol |
| Exact Mass | 655.93 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-4-methyl-N-(1-methylpiperidin-1-ium-1-yl)-3,4-dihydropyrazole-5-carboxamide iodide |
| SMILES | CC1C(C(=O)N[N+]2(C)CCCCC2)=NN(c2ccc(Cl)cc2Cl)C1c1ccc(Br)s1.[I-] |
| InChI | InChI=1S/C21H23BrCl2N4OS.HI/c1-13-19(21(29)26-28(2)10-4-3-5-11-28)25-27(16-7-6-14(23)12-15(16)24)20(13)17-8-9-18(22)30-17;/h6-9,12-13,20H,3-5,10-11H2,1-2H3;1H |
| InChIKey | AXJZLSXURPNQNI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|