C22H28BrCl2N4OS+ — CID 143395073
[[3-(5-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbonyl]amino]-methyl-dipropylazanium (PubChem CID 143395073) has the molecular formula C22H28BrCl2N4OS+ and a molecular weight of 547.37 g/mol. Its IUPAC name is [[3-(5-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbonyl]amino]-methyl-dipropylazanium.
| Compound Name | [[3-(5-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbonyl]amino]-methyl-dipropylazanium |
|---|---|
| PubChem CID | 143395073 |
| Molecular Formula | C22H28BrCl2N4OS+ |
| Molecular Weight | 547.37 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | [[3-(5-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-4-methyl-3,4-dihydropyrazole-5-carbonyl]amino]-methyl-dipropylazanium |
| SMILES | CCC[N+](C)(CCC)NC(=O)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Br)s2)C1C |
| InChI | InChI=1S/C22H27BrCl2N4OS/c1-5-11-29(4,12-6-2)27-22(30)20-14(3)21(18-9-10-19(23)31-18)28(26-20)17-8-7-15(24)13-16(17)25/h7-10,13-14,21H,5-6,11-12H2,1-4H3/p+1 |
| InChIKey | IWOWICIGRVVABX-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.37 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|