C15H11Cl3N2OS — CID 87775218
(3R,4R)-2-(2,4-dichlorophenyl)-4-methyl-3-thiophen-2-yl-3,4-dihydropyrazole-5-carbonyl chloride (PubChem CID 87775218) has the molecular formula C15H11Cl3N2OS and a molecular weight of 373.69 g/mol. Its IUPAC name is (3R,4R)-2-(2,4-dichlorophenyl)-4-methyl-3-thiophen-2-yl-3,4-dihydropyrazole-5-carbonyl chloride.
| Compound Name | (3R,4R)-2-(2,4-dichlorophenyl)-4-methyl-3-thiophen-2-yl-3,4-dihydropyrazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 87775218 |
| Molecular Formula | C15H11Cl3N2OS |
| Molecular Weight | 373.69 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | (3R,4R)-2-(2,4-dichlorophenyl)-4-methyl-3-thiophen-2-yl-3,4-dihydropyrazole-5-carbonyl chloride |
| SMILES | C[C@H]1C(C(=O)Cl)=NN(c2ccc(Cl)cc2Cl)[C@H]1c1cccs1 |
| InChI | InChI=1S/C15H11Cl3N2OS/c1-8-13(15(18)21)19-20(14(8)12-3-2-6-22-12)11-5-4-9(16)7-10(11)17/h2-8,14H,1H3/t8-,14+/m0/s1 |
| InChIKey | FLOIMIDXPUEIHO-RMLUDKJBSA-N |
| XLogP | 5.37 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.69 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|