About [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate
[5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate (PubChem CID 69335868) has the molecular formula C22H19Cl3N4O2
and a molecular weight of 477.78 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate.
Molecular Properties
| Compound Name | [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate |
| PubChem CID | 69335868 |
| Molecular Formula | C22H19Cl3N4O2 |
| Molecular Weight | 477.78 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate |
| SMILES | O=C(NN1CCCCC1)Oc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C22H19Cl3N4O2/c23-15-6-4-14(5-7-15)20-21(17-9-8-16(24)12-18(17)25)27-19(13-26-20)31-22(30)28-29-10-2-1-3-11-29/h4-9,12-13H,1-3,10-11H2,(H,28,30) |
| InChIKey | BHWXRRGVNUYGHQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.78 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate?
The IUPAC name of [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate (CID 69335868) is [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate.
What is the SMILES notation for [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate?
The canonical SMILES for [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate is O=C(NN1CCCCC1)Oc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1.
What is the InChIKey of [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate?
The InChIKey is BHWXRRGVNUYGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Cl3N4O2/c23-15-6-4-14(5-7-15)20-21(17-9-8-16(24)12-18(17)25)27-19(13-26-20)31-22(30)28-29-10-2-1-3-11-29/h4-9,12-13H,1-3,10-11H2,(H,28,30).
What are the key properties of [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate?
[5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate has a molecular weight of 477.78 g/mol, XLogP of 6.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-chlorophenyl)-6-(2,4-dichlorophenyl)pyrazin-2-yl] N-piperidin-1-ylcarbamate is sourced from PubChem (CID 69335868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).