C30H28ClN3O2 — CID 10128252
6-(4-chlorophenyl)-5-phenyl-2-phenylmethoxy-N-piperidin-1-ylpyridine-3-carboxamide (PubChem CID 10128252) has the molecular formula C30H28ClN3O2 and a molecular weight of 498.03 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-5-phenyl-2-phenylmethoxy-N-piperidin-1-ylpyridine-3-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-5-phenyl-2-phenylmethoxy-N-piperidin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 10128252 |
| Molecular Formula | C30H28ClN3O2 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 6-(4-chlorophenyl)-5-phenyl-2-phenylmethoxy-N-piperidin-1-ylpyridine-3-carboxamide |
| SMILES | O=C(NN1CCCCC1)c1cc(-c2ccccc2)c(-c2ccc(Cl)cc2)nc1OCc1ccccc1 |
| InChI | InChI=1S/C30H28ClN3O2/c31-25-16-14-24(15-17-25)28-26(23-12-6-2-7-13-23)20-27(29(35)33-34-18-8-3-9-19-34)30(32-28)36-21-22-10-4-1-5-11-22/h1-2,4-7,10-17,20H,3,8-9,18-19,21H2,(H,33,35) |
| InChIKey | RDHXJIZOOFBKSO-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |