C19H21ClN4O2 — CID 122684622
[6-(3-chlorophenyl)-5-cyclopropylpyrazin-2-yl] N-piperidin-1-ylcarbamate (PubChem CID 122684622) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is [6-(3-chlorophenyl)-5-cyclopropylpyrazin-2-yl] N-piperidin-1-ylcarbamate.
| Compound Name | [6-(3-chlorophenyl)-5-cyclopropylpyrazin-2-yl] N-piperidin-1-ylcarbamate |
|---|---|
| PubChem CID | 122684622 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [6-(3-chlorophenyl)-5-cyclopropylpyrazin-2-yl] N-piperidin-1-ylcarbamate |
| SMILES | O=C(NN1CCCCC1)Oc1cnc(C2CC2)c(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H21ClN4O2/c20-15-6-4-5-14(11-15)18-17(13-7-8-13)21-12-16(22-18)26-19(25)23-24-9-2-1-3-10-24/h4-6,11-13H,1-3,7-10H2,(H,23,25) |
| InChIKey | QJMIMNXHLPSQOQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |