C13H10O3S2 — CID 6933857
S-thiophen-2-yl (3R)-2,3-dihydro-1,4-benzodioxine-3-carbothioate (PubChem CID 6933857) has the molecular formula C13H10O3S2 and a molecular weight of 278.35 g/mol. Its IUPAC name is S-thiophen-2-yl (3R)-2,3-dihydro-1,4-benzodioxine-3-carbothioate.
| Compound Name | S-thiophen-2-yl (3R)-2,3-dihydro-1,4-benzodioxine-3-carbothioate |
|---|---|
| PubChem CID | 6933857 |
| Molecular Formula | C13H10O3S2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | S-thiophen-2-yl (3R)-2,3-dihydro-1,4-benzodioxine-3-carbothioate |
| SMILES | O=C(Sc1cccs1)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C13H10O3S2/c14-13(18-12-6-3-7-17-12)11-8-15-9-4-1-2-5-10(9)16-11/h1-7,11H,8H2/t11-/m1/s1 |
| InChIKey | YLUSACHFBSJBKZ-LLVKDONJSA-N |
| XLogP | 3.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|