C13H19N4+ — CID 69341066
1-pyridazin-3-ylspiro[1-azoniabicyclo[2.2.1]heptane-2,3'-pyrrolidine] (PubChem CID 69341066) has the molecular formula C13H19N4+ and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-pyridazin-3-ylspiro[1-azoniabicyclo[2.2.1]heptane-2,3'-pyrrolidine].
| Compound Name | 1-pyridazin-3-ylspiro[1-azoniabicyclo[2.2.1]heptane-2,3'-pyrrolidine] |
|---|---|
| PubChem CID | 69341066 |
| Molecular Formula | C13H19N4+ |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-pyridazin-3-ylspiro[1-azoniabicyclo[2.2.1]heptane-2,3'-pyrrolidine] |
| SMILES | c1cnnc([N+]23CCC(CC24CCNC4)C3)c1 |
| InChI | InChI=1S/C13H19N4/c1-2-12(16-15-5-1)17-7-3-11(9-17)8-13(17)4-6-14-10-13/h1-2,5,11,14H,3-4,6-10H2/q+1 |
| InChIKey | SXUWGZXHAAPQHC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|