C20H25NO2 — CID 693427
N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-4-methylbenzamide (PubChem CID 693427) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-4-methylbenzamide.
| Compound Name | N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 693427 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(C)C)c(O)c(C(C)C)c2)cc1 |
| InChI | InChI=1S/C20H25NO2/c1-12(2)17-10-16(11-18(13(3)4)19(17)22)21-20(23)15-8-6-14(5)7-9-15/h6-13,22H,1-5H3,(H,21,23) |
| InChIKey | GMTGSELMBMYKMU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|