C34H43NO3 — CID 69344036
(E)-6-[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-phenylmethoxyphenyl]hex-5-enoic acid (PubChem CID 69344036) has the molecular formula C34H43NO3 and a molecular weight of 513.72 g/mol. Its IUPAC name is (E)-6-[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-phenylmethoxyphenyl]hex-5-enoic acid.
| Compound Name | (E)-6-[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-phenylmethoxyphenyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 69344036 |
| Molecular Formula | C34H43NO3 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | (E)-6-[3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-phenylmethoxyphenyl]hex-5-enoic acid |
| SMILES | CC(C)N(CC[C@H](c1ccccc1)c1cc(/C=C/CCCC(=O)O)ccc1OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C34H43NO3/c1-26(2)35(27(3)4)23-22-31(30-17-11-7-12-18-30)32-24-28(14-8-6-13-19-34(36)37)20-21-33(32)38-25-29-15-9-5-10-16-29/h5,7-12,14-18,20-21,24,26-27,31H,6,13,19,22-23,25H2,1-4H3,(H,36,37)/b14-8+/t31-/m1/s1 |
| InChIKey | WQQCLUUXZXDTMS-VTWXSQTASA-N |
| XLogP | 8.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|