C19H18ClN3OS — CID 69344212
5-(3-chloro-4-methoxyphenyl)-2-ethylsulfanyl-6-phenylpyrimidin-4-amine (PubChem CID 69344212) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is 5-(3-chloro-4-methoxyphenyl)-2-ethylsulfanyl-6-phenylpyrimidin-4-amine.
| Compound Name | 5-(3-chloro-4-methoxyphenyl)-2-ethylsulfanyl-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 69344212 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 5-(3-chloro-4-methoxyphenyl)-2-ethylsulfanyl-6-phenylpyrimidin-4-amine |
| SMILES | CCSc1nc(N)c(-c2ccc(OC)c(Cl)c2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H18ClN3OS/c1-3-25-19-22-17(12-7-5-4-6-8-12)16(18(21)23-19)13-9-10-15(24-2)14(20)11-13/h4-11H,3H2,1-2H3,(H2,21,22,23) |
| InChIKey | GJDXAHXOPPXSLG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |