C13H22O2 — CID 69345871
6-hexyl-3,4-dimethyl-2H-pyran-5-one (PubChem CID 69345871) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 6-hexyl-3,4-dimethyl-2H-pyran-5-one.
| Compound Name | 6-hexyl-3,4-dimethyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 69345871 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 6-hexyl-3,4-dimethyl-2H-pyran-5-one |
| SMILES | CCCCCCC1OCC(C)=C(C)C1=O |
| InChI | InChI=1S/C13H22O2/c1-4-5-6-7-8-12-13(14)11(3)10(2)9-15-12/h12H,4-9H2,1-3H3 |
| InChIKey | MYRUKMQVHQRVGN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|