C18H19NO5 — CID 69347899
1,3-dimethoxy-5-[(Z)-1-(3-nitrophenoxy)but-2-en-2-yl]benzene (PubChem CID 69347899) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1,3-dimethoxy-5-[(Z)-1-(3-nitrophenoxy)but-2-en-2-yl]benzene.
| Compound Name | 1,3-dimethoxy-5-[(Z)-1-(3-nitrophenoxy)but-2-en-2-yl]benzene |
|---|---|
| PubChem CID | 69347899 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1,3-dimethoxy-5-[(Z)-1-(3-nitrophenoxy)but-2-en-2-yl]benzene |
| SMILES | C/C=C(\COc1cccc([N+](=O)[O-])c1)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C18H19NO5/c1-4-13(14-8-17(22-2)11-18(9-14)23-3)12-24-16-7-5-6-15(10-16)19(20)21/h4-11H,12H2,1-3H3/b13-4+ |
| InChIKey | NVUGFHYXKMBXNK-YIXHJXPBSA-N |
| XLogP | 4.09 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|