C15H18Cl2N2O3 — CID 69349520
cyclohexyl 2-[(2-amino-4,5-dichlorobenzoyl)amino]acetate (PubChem CID 69349520) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is cyclohexyl 2-[(2-amino-4,5-dichlorobenzoyl)amino]acetate.
| Compound Name | cyclohexyl 2-[(2-amino-4,5-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 69349520 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | cyclohexyl 2-[(2-amino-4,5-dichlorobenzoyl)amino]acetate |
| SMILES | Nc1cc(Cl)c(Cl)cc1C(=O)NCC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C15H18Cl2N2O3/c16-11-6-10(13(18)7-12(11)17)15(21)19-8-14(20)22-9-4-2-1-3-5-9/h6-7,9H,1-5,8,18H2,(H,19,21) |
| InChIKey | BOZFFTPPRVWENI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|