C16H20N2O3S — CID 69349601
ethyl 6-(2-aminoethylsulfanyl)-7-ethyl-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 69349601) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl 6-(2-aminoethylsulfanyl)-7-ethyl-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 6-(2-aminoethylsulfanyl)-7-ethyl-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 69349601 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | ethyl 6-(2-aminoethylsulfanyl)-7-ethyl-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2cc(CC)c(SCCN)cc2c1=O |
| InChI | InChI=1S/C16H20N2O3S/c1-3-10-7-13-11(8-14(10)22-6-5-17)15(19)12(9-18-13)16(20)21-4-2/h7-9H,3-6,17H2,1-2H3,(H,18,19) |
| InChIKey | LSJVJTYCVXGJKV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |