C16H13NO5 — CID 10851683
ethyl 4-methyl-2,6-dioxo-9H-pyrano[3,2-g]quinoline-7-carboxylate (PubChem CID 10851683) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is ethyl 4-methyl-2,6-dioxo-9H-pyrano[3,2-g]quinoline-7-carboxylate.
| Compound Name | ethyl 4-methyl-2,6-dioxo-9H-pyrano[3,2-g]quinoline-7-carboxylate |
|---|---|
| PubChem CID | 10851683 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | ethyl 4-methyl-2,6-dioxo-9H-pyrano[3,2-g]quinoline-7-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2cc3oc(=O)cc(C)c3cc2c1=O |
| InChI | InChI=1S/C16H13NO5/c1-3-21-16(20)11-7-17-12-6-13-9(5-10(12)15(11)19)8(2)4-14(18)22-13/h4-7H,3H2,1-2H3,(H,17,19) |
| InChIKey | GGSXBUZKEAHLFZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|