C29H32Cl2N2O — CID 69351307
N-benzyl-N-[3,4-bis(4-chlorophenyl)butan-2-yl]piperidine-2-carboxamide (PubChem CID 69351307) has the molecular formula C29H32Cl2N2O and a molecular weight of 495.49 g/mol. Its IUPAC name is N-benzyl-N-[3,4-bis(4-chlorophenyl)butan-2-yl]piperidine-2-carboxamide.
| Compound Name | N-benzyl-N-[3,4-bis(4-chlorophenyl)butan-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 69351307 |
| Molecular Formula | C29H32Cl2N2O |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-benzyl-N-[3,4-bis(4-chlorophenyl)butan-2-yl]piperidine-2-carboxamide |
| SMILES | CC(C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1)N(Cc1ccccc1)C(=O)C1CCCCN1 |
| InChI | InChI=1S/C29H32Cl2N2O/c1-21(27(24-12-16-26(31)17-13-24)19-22-10-14-25(30)15-11-22)33(20-23-7-3-2-4-8-23)29(34)28-9-5-6-18-32-28/h2-4,7-8,10-17,21,27-28,32H,5-6,9,18-20H2,1H3 |
| InChIKey | SASMMIMJPKOBEM-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |