C29H30FN3O7 — CID 69352387
[10-(dimethylamino)-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-methoxy-2,3-dioxo-11-azatricyclo[6.2.1.04,9]undeca-1(10),4(9),5,7-tetraen-11-yl] ethyl carbonate (PubChem CID 69352387) has the molecular formula C29H30FN3O7 and a molecular weight of 551.57 g/mol. Its IUPAC name is [10-(dimethylamino)-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-methoxy-2,3-dioxo-11-azatricyclo[6.2.1.04,9]undeca-1(10),4(9),5,7-tetraen-11-yl] ethyl carbonate.
| Compound Name | [10-(dimethylamino)-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-methoxy-2,3-dioxo-11-azatricyclo[6.2.1.04,9]undeca-1(10),4(9),5,7-tetraen-11-yl] ethyl carbonate |
|---|---|
| PubChem CID | 69352387 |
| Molecular Formula | C29H30FN3O7 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | [10-(dimethylamino)-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-methoxy-2,3-dioxo-11-azatricyclo[6.2.1.04,9]undeca-1(10),4(9),5,7-tetraen-11-yl] ethyl carbonate |
| SMILES | CCOC(=O)On1c2c(N(C)C)c3c(c(C(=O)N4CCC(Cc5ccc(F)cc5)CC4)c(OC)cc31)C(=O)C2=O |
| InChI | InChI=1S/C29H30FN3O7/c1-5-39-29(37)40-33-19-15-20(38-4)22(23-21(19)24(31(2)3)25(33)27(35)26(23)34)28(36)32-12-10-17(11-13-32)14-16-6-8-18(30)9-7-16/h6-9,15,17H,5,10-14H2,1-4H3 |
| InChIKey | PKLSAEUPFLFPSS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 107.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|