C22H15F3N4O2 — CID 69353347
5-cyano-4-(4-cyanophenyl)-6-methyl-2-oxo-N-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyridine-3-carboxamide (PubChem CID 69353347) has the molecular formula C22H15F3N4O2 and a molecular weight of 424.38 g/mol. Its IUPAC name is 5-cyano-4-(4-cyanophenyl)-6-methyl-2-oxo-N-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyridine-3-carboxamide.
| Compound Name | 5-cyano-4-(4-cyanophenyl)-6-methyl-2-oxo-N-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69353347 |
| Molecular Formula | C22H15F3N4O2 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 5-cyano-4-(4-cyanophenyl)-6-methyl-2-oxo-N-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyridine-3-carboxamide |
| SMILES | CC1=C(C#N)C(c2ccc(C#N)cc2)C(C(=O)Nc2cccc(C(F)(F)F)c2)C(=O)N1 |
| InChI | InChI=1S/C22H15F3N4O2/c1-12-17(11-27)18(14-7-5-13(10-26)6-8-14)19(20(30)28-12)21(31)29-16-4-2-3-15(9-16)22(23,24)25/h2-9,18-19H,1H3,(H,28,30)(H,29,31) |
| InChIKey | PBUJEANOVHCZTP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|