C19H29N5O4S — CID 69358116
1-[3-[4-(pyridine-3-carbonyl)piperazin-1-yl]sulfonylpropyl]piperidine-4-carboxamide (PubChem CID 69358116) has the molecular formula C19H29N5O4S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-[3-[4-(pyridine-3-carbonyl)piperazin-1-yl]sulfonylpropyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[4-(pyridine-3-carbonyl)piperazin-1-yl]sulfonylpropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 69358116 |
| Molecular Formula | C19H29N5O4S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-[3-[4-(pyridine-3-carbonyl)piperazin-1-yl]sulfonylpropyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCCS(=O)(=O)N2CCN(C(=O)c3cccnc3)CC2)CC1 |
| InChI | InChI=1S/C19H29N5O4S/c20-18(25)16-4-8-22(9-5-16)7-2-14-29(27,28)24-12-10-23(11-13-24)19(26)17-3-1-6-21-15-17/h1,3,6,15-16H,2,4-5,7-14H2,(H2,20,25) |
| InChIKey | LQKBYJDWPNPWNX-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |