C34H45N3O6S — CID 69360415
3-cyclopentyl-5-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-N-[(2S,3S)-4-[(3,5-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]benzamide (PubChem CID 69360415) has the molecular formula C34H45N3O6S and a molecular weight of 623.82 g/mol. Its IUPAC name is 3-cyclopentyl-5-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-N-[(2S,3S)-4-[(3,5-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]benzamide.
| Compound Name | 3-cyclopentyl-5-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-N-[(2S,3S)-4-[(3,5-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 69360415 |
| Molecular Formula | C34H45N3O6S |
| Molecular Weight | 623.82 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | 3-cyclopentyl-5-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-N-[(2S,3S)-4-[(3,5-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]benzamide |
| SMILES | COc1cc(CNC[C@H](O)[C@H](Cc2ccccc2)NC(=O)c2cc(C3CCCC3)cc(N3CCCS3(O)O)c2)cc(OC)c1 |
| InChI | InChI=1S/C34H45N3O6S/c1-42-30-15-25(16-31(21-30)43-2)22-35-23-33(38)32(17-24-9-4-3-5-10-24)36-34(39)28-18-27(26-11-6-7-12-26)19-29(20-28)37-13-8-14-44(37,40)41/h3-5,9-10,15-16,18-21,26,32-33,35,38,40-41H,6-8,11-14,17,22-23H2,1-2H3,(H,36,39)/t32-,33-/m0/s1 |
| InChIKey | OSCDKANNLANCNN-LQJZCPKCSA-N |
| XLogP | 5.73 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |