C31H42ClN3O7S — CID 69359718
3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-N-[(2S,3R)-4-[(3,5-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethoxybenzamide;hydrochloride (PubChem CID 69359718) has the molecular formula C31H42ClN3O7S and a molecular weight of 636.21 g/mol. Its IUPAC name is 3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-N-[(2S,3R)-4-[(3,5-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethoxybenzamide;hydrochloride.
| Compound Name | 3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-N-[(2S,3R)-4-[(3,5-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 69359718 |
| Molecular Formula | C31H42ClN3O7S |
| Molecular Weight | 636.21 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | 3-(1,1-dihydroxy-1,2-thiazolidin-2-yl)-N-[(2S,3R)-4-[(3,5-dimethoxyphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethoxybenzamide;hydrochloride |
| SMILES | CCOc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNCc2cc(OC)cc(OC)c2)cc(N2CCCS2(O)O)c1.Cl |
| InChI | InChI=1S/C31H41N3O7S.ClH/c1-4-41-28-17-24(16-25(18-28)34-11-8-12-42(34,37)38)31(36)33-29(15-22-9-6-5-7-10-22)30(35)21-32-20-23-13-26(39-2)19-27(14-23)40-3;/h5-7,9-10,13-14,16-19,29-30,32,35,37-38H,4,8,11-12,15,20-21H2,1-3H3,(H,33,36);1H/t29-,30+;/m0./s1 |
| InChIKey | FZRBLTBFRNHSCB-XCCPJCIBSA-N |
| XLogP | 4.89 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.21 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |