C14H15N2O3- — CID 6936228
3-[(2S)-2-acetamidopropyl]-1H-indole-2-carboxylate (PubChem CID 6936228) has the molecular formula C14H15N2O3- and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-[(2S)-2-acetamidopropyl]-1H-indole-2-carboxylate.
| Compound Name | 3-[(2S)-2-acetamidopropyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 6936228 |
| Molecular Formula | C14H15N2O3- |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-[(2S)-2-acetamidopropyl]-1H-indole-2-carboxylate |
| SMILES | CC(=O)N[C@@H](C)Cc1c(C(=O)[O-])[nH]c2ccccc12 |
| InChI | InChI=1S/C14H16N2O3/c1-8(15-9(2)17)7-11-10-5-3-4-6-12(10)16-13(11)14(18)19/h3-6,8,16H,7H2,1-2H3,(H,15,17)(H,18,19)/p-1/t8-/m0/s1 |
| InChIKey | JCOKHKWSBDTOOB-QMMMGPOBSA-M |
| XLogP | 0.60 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|