About 7-(furan-2-yl)-1,3-benzoxazol-5-ol
7-(furan-2-yl)-1,3-benzoxazol-5-ol (PubChem CID 69362496) has the molecular formula C11H7NO3
and a molecular weight of 201.18 g/mol. Its IUPAC name is 7-(furan-2-yl)-1,3-benzoxazol-5-ol.
Molecular Properties
| Compound Name | 7-(furan-2-yl)-1,3-benzoxazol-5-ol |
| PubChem CID | 69362496 |
| Molecular Formula | C11H7NO3 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 7-(furan-2-yl)-1,3-benzoxazol-5-ol |
| SMILES | Oc1cc(-c2ccco2)c2ocnc2c1 |
| InChI | InChI=1S/C11H7NO3/c13-7-4-8(10-2-1-3-14-10)11-9(5-7)12-6-15-11/h1-6,13H |
| InChIKey | OFZQQWZDKMKKCY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(furan-2-yl)-1,3-benzoxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(furan-2-yl)-1,3-benzoxazol-5-ol?
The IUPAC name of 7-(furan-2-yl)-1,3-benzoxazol-5-ol (CID 69362496) is 7-(furan-2-yl)-1,3-benzoxazol-5-ol.
What is the SMILES notation for 7-(furan-2-yl)-1,3-benzoxazol-5-ol?
The canonical SMILES for 7-(furan-2-yl)-1,3-benzoxazol-5-ol is Oc1cc(-c2ccco2)c2ocnc2c1.
What is the InChIKey of 7-(furan-2-yl)-1,3-benzoxazol-5-ol?
The InChIKey is OFZQQWZDKMKKCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO3/c13-7-4-8(10-2-1-3-14-10)11-9(5-7)12-6-15-11/h1-6,13H.
What are the key properties of 7-(furan-2-yl)-1,3-benzoxazol-5-ol?
7-(furan-2-yl)-1,3-benzoxazol-5-ol has a molecular weight of 201.18 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(furan-2-yl)-1,3-benzoxazol-5-ol is sourced from PubChem (CID 69362496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).