C7H6N2O2 — CID 96636219
4-(furan-2-yl)-1,3-oxazol-5-amine (PubChem CID 96636219) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 4-(furan-2-yl)-1,3-oxazol-5-amine.
| Compound Name | 4-(furan-2-yl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 96636219 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 4-(furan-2-yl)-1,3-oxazol-5-amine |
| SMILES | Nc1ocnc1-c1ccco1 |
| InChI | InChI=1S/C7H6N2O2/c8-7-6(9-4-11-7)5-2-1-3-10-5/h1-4H,8H2 |
| InChIKey | CAGJNIHJPQCAPM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |