C12H10N2O2 — CID 12582451
4,5-bis(furan-2-yl)-1-methylimidazole (PubChem CID 12582451) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4,5-bis(furan-2-yl)-1-methylimidazole.
| Compound Name | 4,5-bis(furan-2-yl)-1-methylimidazole |
|---|---|
| PubChem CID | 12582451 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4,5-bis(furan-2-yl)-1-methylimidazole |
| SMILES | Cn1cnc(-c2ccco2)c1-c1ccco1 |
| InChI | InChI=1S/C12H10N2O2/c1-14-8-13-11(9-4-2-6-15-9)12(14)10-5-3-7-16-10/h2-8H,1H3 |
| InChIKey | UEGNMZUBQDCJDC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |