C28H30Cl2N2O2 — CID 69362578
N-[(4-tert-butylphenyl)methyl]-2-(3,4-dichlorophenyl)ethanamine;1H-indole-7-carboxylic acid (PubChem CID 69362578) has the molecular formula C28H30Cl2N2O2 and a molecular weight of 497.47 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2-(3,4-dichlorophenyl)ethanamine;1H-indole-7-carboxylic acid.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2-(3,4-dichlorophenyl)ethanamine;1H-indole-7-carboxylic acid |
|---|---|
| PubChem CID | 69362578 |
| Molecular Formula | C28H30Cl2N2O2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2-(3,4-dichlorophenyl)ethanamine;1H-indole-7-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(CNCCc2ccc(Cl)c(Cl)c2)cc1.O=C(O)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C19H23Cl2N.C9H7NO2/c1-19(2,3)16-7-4-15(5-8-16)13-22-11-10-14-6-9-17(20)18(21)12-14;11-9(12)7-3-1-2-6-4-5-10-8(6)7/h4-9,12,22H,10-11,13H2,1-3H3;1-5,10H,(H,11,12) |
| InChIKey | BBUXZCOCVXDFQO-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|