C18H16BrCl3N2O2S — CID 69362890
2-[1-(2-bromophenyl)sulfonyl-4,6,7-trichloroindol-3-yl]-N,N-dimethylethanamine (PubChem CID 69362890) has the molecular formula C18H16BrCl3N2O2S and a molecular weight of 510.67 g/mol. Its IUPAC name is 2-[1-(2-bromophenyl)sulfonyl-4,6,7-trichloroindol-3-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[1-(2-bromophenyl)sulfonyl-4,6,7-trichloroindol-3-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 69362890 |
| Molecular Formula | C18H16BrCl3N2O2S |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 507.92 |
| IUPAC Name | 2-[1-(2-bromophenyl)sulfonyl-4,6,7-trichloroindol-3-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1cn(S(=O)(=O)c2ccccc2Br)c2c(Cl)c(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C18H16BrCl3N2O2S/c1-23(2)8-7-11-10-24(18-16(11)13(20)9-14(21)17(18)22)27(25,26)15-6-4-3-5-12(15)19/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | QNIZWAXRLOHVNI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|