About [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate
[4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate (PubChem CID 69365611) has the molecular formula C18H28INO3
and a molecular weight of 433.33 g/mol. Its IUPAC name is [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate.
Molecular Properties
| Compound Name | [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate |
| PubChem CID | 69365611 |
| Molecular Formula | C18H28INO3 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate |
| SMILES | Cc1cc(OCCN(C)C)c(C(C)C)cc1OC(=O)CCCI |
| InChI | InChI=1S/C18H28INO3/c1-13(2)15-12-16(23-18(21)7-6-8-19)14(3)11-17(15)22-10-9-20(4)5/h11-13H,6-10H2,1-5H3 |
| InChIKey | NDKCORKFFPTXOJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate?
The IUPAC name of [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate (CID 69365611) is [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate.
What is the SMILES notation for [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate?
The canonical SMILES for [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate is Cc1cc(OCCN(C)C)c(C(C)C)cc1OC(=O)CCCI.
What is the InChIKey of [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate?
The InChIKey is NDKCORKFFPTXOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28INO3/c1-13(2)15-12-16(23-18(21)7-6-8-19)14(3)11-17(15)22-10-9-20(4)5/h11-13H,6-10H2,1-5H3.
What are the key properties of [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate?
[4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate has a molecular weight of 433.33 g/mol, XLogP of 4.18, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(dimethylamino)ethoxy]-2-methyl-5-propan-2-ylphenyl] 4-iodobutanoate is sourced from PubChem (CID 69365611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).