C19H29N5O2S — CID 69366065
3-amino-4-[3-[3-(dimethylamino)propoxymethyl]piperidin-1-yl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 69366065) has the molecular formula C19H29N5O2S and a molecular weight of 391.54 g/mol. Its IUPAC name is 3-amino-4-[3-[3-(dimethylamino)propoxymethyl]piperidin-1-yl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4-[3-[3-(dimethylamino)propoxymethyl]piperidin-1-yl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 69366065 |
| Molecular Formula | C19H29N5O2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-amino-4-[3-[3-(dimethylamino)propoxymethyl]piperidin-1-yl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CN(C)CCCOCC1CCCN(c2ccnc3sc(C(N)=O)c(N)c23)C1 |
| InChI | InChI=1S/C19H29N5O2S/c1-23(2)8-4-10-26-12-13-5-3-9-24(11-13)14-6-7-22-19-15(14)16(20)17(27-19)18(21)25/h6-7,13H,3-5,8-12,20H2,1-2H3,(H2,21,25) |
| InChIKey | LUNLTVWGMDXBME-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|