C17H26N4OS — CID 87798831
4-[3-[3-(dimethylamino)propoxymethyl]piperidin-1-yl]-2-sulfanylidene-1H-pyridine-3-carbonitrile (PubChem CID 87798831) has the molecular formula C17H26N4OS and a molecular weight of 334.49 g/mol. Its IUPAC name is 4-[3-[3-(dimethylamino)propoxymethyl]piperidin-1-yl]-2-sulfanylidene-1H-pyridine-3-carbonitrile.
| Compound Name | 4-[3-[3-(dimethylamino)propoxymethyl]piperidin-1-yl]-2-sulfanylidene-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 87798831 |
| Molecular Formula | C17H26N4OS |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 4-[3-[3-(dimethylamino)propoxymethyl]piperidin-1-yl]-2-sulfanylidene-1H-pyridine-3-carbonitrile |
| SMILES | CN(C)CCCOCC1CCCN(c2cc[nH]c(=S)c2C#N)C1 |
| InChI | InChI=1S/C17H26N4OS/c1-20(2)8-4-10-22-13-14-5-3-9-21(12-14)16-6-7-19-17(23)15(16)11-18/h6-7,14H,3-5,8-10,12-13H2,1-2H3,(H,19,23) |
| InChIKey | SSCLHNTZEVDQPB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|