C21H31N5O4S — CID 69366737
tert-butyl N-[2-[[1-(3-amino-2-carbamoylthieno[2,3-b]pyridin-4-yl)piperidin-3-yl]methoxy]ethyl]carbamate (PubChem CID 69366737) has the molecular formula C21H31N5O4S and a molecular weight of 449.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(3-amino-2-carbamoylthieno[2,3-b]pyridin-4-yl)piperidin-3-yl]methoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(3-amino-2-carbamoylthieno[2,3-b]pyridin-4-yl)piperidin-3-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 69366737 |
| Molecular Formula | C21H31N5O4S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | tert-butyl N-[2-[[1-(3-amino-2-carbamoylthieno[2,3-b]pyridin-4-yl)piperidin-3-yl]methoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCC1CCCN(c2ccnc3sc(C(N)=O)c(N)c23)C1 |
| InChI | InChI=1S/C21H31N5O4S/c1-21(2,3)30-20(28)25-8-10-29-12-13-5-4-9-26(11-13)14-6-7-24-19-15(14)16(22)17(31-19)18(23)27/h6-7,13H,4-5,8-12,22H2,1-3H3,(H2,23,27)(H,25,28) |
| InChIKey | WGGIWTBPYWIUIS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|