C15H10N2O — CID 69366715
7H-quinolino[7,8-c][1,2]benzoxazine (PubChem CID 69366715) has the molecular formula C15H10N2O and a molecular weight of 234.26 g/mol. Its IUPAC name is 7H-quinolino[7,8-c][1,2]benzoxazine.
| Compound Name | 7H-quinolino[7,8-c][1,2]benzoxazine |
|---|---|
| PubChem CID | 69366715 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 7H-quinolino[7,8-c][1,2]benzoxazine |
| SMILES | c1ccc2c(c1)ONc1ccc3cccnc3c1-2 |
| InChI | InChI=1S/C15H10N2O/c1-2-6-13-11(5-1)14-12(17-18-13)8-7-10-4-3-9-16-15(10)14/h1-9,17H |
| InChIKey | NNMGKTKFHJNUAF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |