C28H36N2O2 — CID 69368253
1-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methyl-methylamino]-3-cyclopentyl-1-hydroxy-1-phenylpropan-2-one (PubChem CID 69368253) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methyl-methylamino]-3-cyclopentyl-1-hydroxy-1-phenylpropan-2-one.
| Compound Name | 1-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methyl-methylamino]-3-cyclopentyl-1-hydroxy-1-phenylpropan-2-one |
|---|---|
| PubChem CID | 69368253 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 1-[(3-benzyl-3-azabicyclo[3.1.0]hexan-6-yl)methyl-methylamino]-3-cyclopentyl-1-hydroxy-1-phenylpropan-2-one |
| SMILES | CN(CC1C2CN(Cc3ccccc3)CC21)C(O)(C(=O)CC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H36N2O2/c1-29(18-24-25-19-30(20-26(24)25)17-22-12-4-2-5-13-22)28(32,23-14-6-3-7-15-23)27(31)16-21-10-8-9-11-21/h2-7,12-15,21,24-26,32H,8-11,16-20H2,1H3 |
| InChIKey | CDHGLBUMWKJPJC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|