C22H21ClN6O2 — CID 69369107
1-(4-chlorophenyl)-3-[4-[2-(1H-imidazol-2-yl)ethoxy]-3-(2-methylpyrazol-3-yl)phenyl]urea (PubChem CID 69369107) has the molecular formula C22H21ClN6O2 and a molecular weight of 436.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[2-(1H-imidazol-2-yl)ethoxy]-3-(2-methylpyrazol-3-yl)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[2-(1H-imidazol-2-yl)ethoxy]-3-(2-methylpyrazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 69369107 |
| Molecular Formula | C22H21ClN6O2 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[2-(1H-imidazol-2-yl)ethoxy]-3-(2-methylpyrazol-3-yl)phenyl]urea |
| SMILES | Cn1nccc1-c1cc(NC(=O)Nc2ccc(Cl)cc2)ccc1OCCc1ncc[nH]1 |
| InChI | InChI=1S/C22H21ClN6O2/c1-29-19(8-10-26-29)18-14-17(28-22(30)27-16-4-2-15(23)3-5-16)6-7-20(18)31-13-9-21-24-11-12-25-21/h2-8,10-12,14H,9,13H2,1H3,(H,24,25)(H2,27,28,30) |
| InChIKey | TZGXYZHYALHTFX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |