C26H33ClN5O3+ — CID 69387795
1-(4-chlorophenyl)-3-[4-[2-(4-ethylmorpholin-4-ium-4-yl)propoxy]-3-(2-methylpyrazol-3-yl)phenyl]urea (PubChem CID 69387795) has the molecular formula C26H33ClN5O3+ and a molecular weight of 499.04 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[2-(4-ethylmorpholin-4-ium-4-yl)propoxy]-3-(2-methylpyrazol-3-yl)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[2-(4-ethylmorpholin-4-ium-4-yl)propoxy]-3-(2-methylpyrazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 69387795 |
| Molecular Formula | C26H33ClN5O3+ |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[2-(4-ethylmorpholin-4-ium-4-yl)propoxy]-3-(2-methylpyrazol-3-yl)phenyl]urea |
| SMILES | CC[N+]1(C(C)COc2ccc(NC(=O)Nc3ccc(Cl)cc3)cc2-c2ccnn2C)CCOCC1 |
| InChI | InChI=1S/C26H32ClN5O3/c1-4-32(13-15-34-16-14-32)19(2)18-35-25-10-9-22(17-23(25)24-11-12-28-31(24)3)30-26(33)29-21-7-5-20(27)6-8-21/h5-12,17,19H,4,13-16,18H2,1-3H3,(H-,29,30,33)/p+1 |
| InChIKey | RKMUMABXNOUZES-UHFFFAOYSA-O |
| XLogP | 5.02 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|