C21H22F4N6O3 — CID 69370850
5-(5-fluoropentyl)-N-(5-methyl-1,2-oxazol-3-yl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide (PubChem CID 69370850) has the molecular formula C21H22F4N6O3 and a molecular weight of 482.44 g/mol. Its IUPAC name is 5-(5-fluoropentyl)-N-(5-methyl-1,2-oxazol-3-yl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide.
| Compound Name | 5-(5-fluoropentyl)-N-(5-methyl-1,2-oxazol-3-yl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 69370850 |
| Molecular Formula | C21H22F4N6O3 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 5-(5-fluoropentyl)-N-(5-methyl-1,2-oxazol-3-yl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2nnn(-c3ccc(C(=O)NCC(F)(F)F)cc3)c2CCCCCF)no1 |
| InChI | InChI=1S/C21H22F4N6O3/c1-13-11-17(29-34-13)27-20(33)18-16(5-3-2-4-10-22)31(30-28-18)15-8-6-14(7-9-15)19(32)26-12-21(23,24)25/h6-9,11H,2-5,10,12H2,1H3,(H,26,32)(H,27,29,33) |
| InChIKey | QKUANALTHZLHKJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|