C25H25F7N6O4 — CID 87800215
5-(5-fluoropentyl)-N-(pyridin-2-ylmethyl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 87800215) has the molecular formula C25H25F7N6O4 and a molecular weight of 606.50 g/mol. Its IUPAC name is 5-(5-fluoropentyl)-N-(pyridin-2-ylmethyl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(5-fluoropentyl)-N-(pyridin-2-ylmethyl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87800215 |
| Molecular Formula | C25H25F7N6O4 |
| Molecular Weight | 606.50 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | 5-(5-fluoropentyl)-N-(pyridin-2-ylmethyl)-1-[4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCC(F)(F)F)c1ccc(-n2nnc(C(=O)NCc3ccccn3)c2CCCCCF)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H24F4N6O2.C2HF3O2/c24-12-4-1-2-7-19-20(22(35)29-14-17-6-3-5-13-28-17)31-32-33(19)18-10-8-16(9-11-18)21(34)30-15-23(25,26)27;3-2(4,5)1(6)7/h3,5-6,8-11,13H,1-2,4,7,12,14-15H2,(H,29,35)(H,30,34);(H,6,7) |
| InChIKey | XQLDBGMWQUYGSO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|