C15H11N4OS+ — CID 6937260
3,6-diamino-2-benzoylthieno[2,3-b]pyridin-7-ium-5-carbonitrile (PubChem CID 6937260) has the molecular formula C15H11N4OS+ and a molecular weight of 295.35 g/mol. Its IUPAC name is 3,6-diamino-2-benzoylthieno[2,3-b]pyridin-7-ium-5-carbonitrile.
| Compound Name | 3,6-diamino-2-benzoylthieno[2,3-b]pyridin-7-ium-5-carbonitrile |
|---|---|
| PubChem CID | 6937260 |
| Molecular Formula | C15H11N4OS+ |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3,6-diamino-2-benzoylthieno[2,3-b]pyridin-7-ium-5-carbonitrile |
| SMILES | N#Cc1cc2c(N)c(C(=O)c3ccccc3)sc2[nH+]c1N |
| InChI | InChI=1S/C15H10N4OS/c16-7-9-6-10-11(17)13(21-15(10)19-14(9)18)12(20)8-4-2-1-3-5-8/h1-6H,17H2,(H2,18,19)/p+1 |
| InChIKey | CNUZUOSGZYOVGA-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |