C16H13N4O2S+ — CID 2212843
benzyl 3,6-diamino-5-cyanothieno[2,3-b]pyridin-7-ium-2-carboxylate (PubChem CID 2212843) has the molecular formula C16H13N4O2S+ and a molecular weight of 325.37 g/mol. Its IUPAC name is benzyl 3,6-diamino-5-cyanothieno[2,3-b]pyridin-7-ium-2-carboxylate.
| Compound Name | benzyl 3,6-diamino-5-cyanothieno[2,3-b]pyridin-7-ium-2-carboxylate |
|---|---|
| PubChem CID | 2212843 |
| Molecular Formula | C16H13N4O2S+ |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | benzyl 3,6-diamino-5-cyanothieno[2,3-b]pyridin-7-ium-2-carboxylate |
| SMILES | N#Cc1cc2c(N)c(C(=O)OCc3ccccc3)sc2[nH+]c1N |
| InChI | InChI=1S/C16H12N4O2S/c17-7-10-6-11-12(18)13(23-15(11)20-14(10)19)16(21)22-8-9-4-2-1-3-5-9/h1-6H,8,18H2,(H2,19,20)/p+1 |
| InChIKey | PIHWVVZCQDRZCI-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |