About benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride
benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride (PubChem CID 158633684) has the molecular formula C17H16ClN3O3
and a molecular weight of 345.79 g/mol. Its IUPAC name is benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride.
Molecular Properties
| Compound Name | benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride |
| PubChem CID | 158633684 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride |
| SMILES | Cl.N#Cc1c[nH]c2ccc(C(=O)OCc3ccccc3)cc12.NO |
| InChI | InChI=1S/C17H12N2O2.ClH.H3NO/c18-9-14-10-19-16-7-6-13(8-15(14)16)17(20)21-11-12-4-2-1-3-5-12;;1-2/h1-8,10,19H,11H2;1H;2H,1H2 |
| InChIKey | VUMWWGRSZGFMDX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride?
The IUPAC name of benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride (CID 158633684) is benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride.
What is the SMILES notation for benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride?
The canonical SMILES for benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride is Cl.N#Cc1c[nH]c2ccc(C(=O)OCc3ccccc3)cc12.NO.
What is the InChIKey of benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride?
The InChIKey is VUMWWGRSZGFMDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2.ClH.H3NO/c18-9-14-10-19-16-7-6-13(8-15(14)16)17(20)21-11-12-4-2-1-3-5-12;;1-2/h1-8,10,19H,11H2;1H;2H,1H2.
What are the key properties of benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride?
benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride has a molecular weight of 345.79 g/mol, XLogP of 3.15, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-cyano-1H-indole-5-carboxylate;hydroxylamine;hydrochloride is sourced from PubChem (CID 158633684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).